C10H15N3O3S — CID 66379938
2-[[3-(ethylamino)propanoylamino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66379938) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[[3-(ethylamino)propanoylamino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[3-(ethylamino)propanoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66379938 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[[3-(ethylamino)propanoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCNCCC(=O)NCc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C10H15N3O3S/c1-2-11-4-3-8(14)12-5-9-13-7(6-17-9)10(15)16/h6,11H,2-5H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | HOXZYCSSNSBSHF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|