C21H24N2O3S2 — CID 8940627
4-(4-ethoxyphenoxy)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]butanamide (PubChem CID 8940627) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-(4-ethoxyphenoxy)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]butanamide.
| Compound Name | 4-(4-ethoxyphenoxy)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 8940627 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-(4-ethoxyphenoxy)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]butanamide |
| SMILES | CCOc1ccc(OCCCC(=O)NCc2ccc(-c3csc(C)n3)s2)cc1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-3-25-16-6-8-17(9-7-16)26-12-4-5-21(24)22-13-18-10-11-20(28-18)19-14-27-15(2)23-19/h6-11,14H,3-5,12-13H2,1-2H3,(H,22,24) |
| InChIKey | KLFTYETXMADOJM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|