C11H11N5O2S2 — CID 21148157
S-(methylamino) N-amino-N-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)carbamothioate (PubChem CID 21148157) has the molecular formula C11H11N5O2S2 and a molecular weight of 309.38 g/mol. Its IUPAC name is S-(methylamino) N-amino-N-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)carbamothioate.
| Compound Name | S-(methylamino) N-amino-N-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)carbamothioate |
|---|---|
| PubChem CID | 21148157 |
| Molecular Formula | C11H11N5O2S2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | S-(methylamino) N-amino-N-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)carbamothioate |
| SMILES | CNSC(=O)N(N)C(=O)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C11H11N5O2S2/c1-13-20-11(18)16(12)10(17)8-6-19-9(15-8)7-3-2-4-14-5-7/h2-6,13H,12H2,1H3 |
| InChIKey | ZNZJCRQNYSKNJT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|