C14H11N5OS — CID 18772022
1-pyridin-3-yl-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea (PubChem CID 18772022) has the molecular formula C14H11N5OS and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-pyridin-3-yl-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-pyridin-3-yl-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 18772022 |
| Molecular Formula | C14H11N5OS |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-pyridin-3-yl-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
| SMILES | O=C(Nc1cccnc1)Nc1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C14H11N5OS/c20-14(17-11-4-2-6-16-8-11)19-12-9-21-13(18-12)10-3-1-5-15-7-10/h1-9H,(H2,17,19,20) |
| InChIKey | WQCXHJWRFIHVKC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |