C16H17IN4O2S — CID 163640903
1-(3-tert-butyl-1λ3-ioda-2-oxacyclopenta-3,5-dien-5-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea (PubChem CID 163640903) has the molecular formula C16H17IN4O2S and a molecular weight of 456.31 g/mol. Its IUPAC name is 1-(3-tert-butyl-1λ3-ioda-2-oxacyclopenta-3,5-dien-5-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-(3-tert-butyl-1λ3-ioda-2-oxacyclopenta-3,5-dien-5-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 163640903 |
| Molecular Formula | C16H17IN4O2S |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 1-(3-tert-butyl-1λ3-ioda-2-oxacyclopenta-3,5-dien-5-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
| SMILES | CC(C)(C)C1=CC(NC(=O)Nc2csc(-c3cccnc3)n2)=IO1 |
| InChI | InChI=1S/C16H17IN4O2S/c1-16(2,3)11-7-12(17-23-11)19-15(22)21-13-9-24-14(20-13)10-5-4-6-18-8-10/h4-9H,1-3H3,(H2,19,21,22) |
| InChIKey | IEEAHPFKJVVBKU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|