C14H12BrF3N2O2S — CID 78852271
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 78852271) has the molecular formula C14H12BrF3N2O2S and a molecular weight of 409.23 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 78852271 |
| Molecular Formula | C14H12BrF3N2O2S |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)Nc1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C14H12BrF3N2O2S/c15-10-3-1-2-9(6-10)11-7-23-13(19-11)20-12(21)4-5-22-8-14(16,17)18/h1-3,6-7H,4-5,8H2,(H,19,20,21) |
| InChIKey | LMLPAIZJJGLLRS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|