C17H24N2O6S — CID 7521382
ethyl 4-(ethoxycarbonylcarbamoyl)-3-methyl-5-(pentanoylamino)thiophene-2-carboxylate (PubChem CID 7521382) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is ethyl 4-(ethoxycarbonylcarbamoyl)-3-methyl-5-(pentanoylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 4-(ethoxycarbonylcarbamoyl)-3-methyl-5-(pentanoylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7521382 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl 4-(ethoxycarbonylcarbamoyl)-3-methyl-5-(pentanoylamino)thiophene-2-carboxylate |
| SMILES | CCCCC(=O)Nc1sc(C(=O)OCC)c(C)c1C(=O)NC(=O)OCC |
| InChI | InChI=1S/C17H24N2O6S/c1-5-8-9-11(20)18-15-12(14(21)19-17(23)25-7-3)10(4)13(26-15)16(22)24-6-2/h5-9H2,1-4H3,(H,18,20)(H,19,21,23) |
| InChIKey | FUDUYWZHCDGFOY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |