C23H38N2O4S — CID 3456743
propan-2-yl 5-(diethylcarbamoyl)-4-methyl-2-(nonanoylamino)thiophene-3-carboxylate (PubChem CID 3456743) has the molecular formula C23H38N2O4S and a molecular weight of 438.63 g/mol. Its IUPAC name is propan-2-yl 5-(diethylcarbamoyl)-4-methyl-2-(nonanoylamino)thiophene-3-carboxylate.
| Compound Name | propan-2-yl 5-(diethylcarbamoyl)-4-methyl-2-(nonanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3456743 |
| Molecular Formula | C23H38N2O4S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | propan-2-yl 5-(diethylcarbamoyl)-4-methyl-2-(nonanoylamino)thiophene-3-carboxylate |
| SMILES | CCCCCCCCC(=O)Nc1sc(C(=O)N(CC)CC)c(C)c1C(=O)OC(C)C |
| InChI | InChI=1S/C23H38N2O4S/c1-7-10-11-12-13-14-15-18(26)24-21-19(23(28)29-16(4)5)17(6)20(30-21)22(27)25(8-2)9-3/h16H,7-15H2,1-6H3,(H,24,26) |
| InChIKey | AHOIUHSXIVWQAV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|