C16H22Cl2N2O4S — CID 1028227
propan-2-yl 2-[(2,2-dichloroacetyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 1028227) has the molecular formula C16H22Cl2N2O4S and a molecular weight of 409.34 g/mol. Its IUPAC name is propan-2-yl 2-[(2,2-dichloroacetyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[(2,2-dichloroacetyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1028227 |
| Molecular Formula | C16H22Cl2N2O4S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | propan-2-yl 2-[(2,2-dichloroacetyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=O)C(Cl)Cl)c(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C16H22Cl2N2O4S/c1-6-20(7-2)15(22)11-9(5)10(16(23)24-8(3)4)14(25-11)19-13(21)12(17)18/h8,12H,6-7H2,1-5H3,(H,19,21) |
| InChIKey | KTMCPLHUDCIDNC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|