C7H10N2O2S2 — CID 103526720
3-amino-4-methoxy-5-methylsulfanylthiophene-2-carboxamide (PubChem CID 103526720) has the molecular formula C7H10N2O2S2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-amino-4-methoxy-5-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-4-methoxy-5-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103526720 |
| Molecular Formula | C7H10N2O2S2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 3-amino-4-methoxy-5-methylsulfanylthiophene-2-carboxamide |
| SMILES | COc1c(SC)sc(C(N)=O)c1N |
| InChI | InChI=1S/C7H10N2O2S2/c1-11-4-3(8)5(6(9)10)13-7(4)12-2/h8H2,1-2H3,(H2,9,10) |
| InChIKey | HZTOKRKQFARNPI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |