C17H16N2O3S2 — CID 68524574
4-cyano-5-methylsulfanyl-3-[4-(propan-2-ylcarbamoyl)phenyl]thiophene-2-carboxylic acid (PubChem CID 68524574) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-cyano-5-methylsulfanyl-3-[4-(propan-2-ylcarbamoyl)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-cyano-5-methylsulfanyl-3-[4-(propan-2-ylcarbamoyl)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68524574 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 4-cyano-5-methylsulfanyl-3-[4-(propan-2-ylcarbamoyl)phenyl]thiophene-2-carboxylic acid |
| SMILES | CSc1sc(C(=O)O)c(-c2ccc(C(=O)NC(C)C)cc2)c1C#N |
| InChI | InChI=1S/C17H16N2O3S2/c1-9(2)19-15(20)11-6-4-10(5-7-11)13-12(8-18)17(23-3)24-14(13)16(21)22/h4-7,9H,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | UYGHNOPEEDXIPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |