C16H13ClNO2S2- — CID 7032896
5-[(2S)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate (PubChem CID 7032896) has the molecular formula C16H13ClNO2S2- and a molecular weight of 350.87 g/mol. Its IUPAC name is 5-[(2S)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate.
| Compound Name | 5-[(2S)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7032896 |
| Molecular Formula | C16H13ClNO2S2- |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 5-[(2S)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate |
| SMILES | CC[C@H](C)Sc1sc(C(=O)[O-])c(-c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C16H14ClNO2S2/c1-3-9(2)21-16-12(8-18)13(14(22-16)15(19)20)10-4-6-11(17)7-5-10/h4-7,9H,3H2,1-2H3,(H,19,20)/p-1/t9-/m0/s1 |
| InChIKey | IZXSEAJSPXOFLR-VIFPVBQESA-M |
| XLogP | 4.19 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |