C17H17NO4S2 — CID 90667629
ethyl 4-cyano-3-(3,4-dihydroxyphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylate (PubChem CID 90667629) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 4-cyano-3-(3,4-dihydroxyphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-(3,4-dihydroxyphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 90667629 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | ethyl 4-cyano-3-(3,4-dihydroxyphenyl)-5-propan-2-ylsulfanylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(SC(C)C)c(C#N)c1-c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H17NO4S2/c1-4-22-16(21)15-14(10-5-6-12(19)13(20)7-10)11(8-18)17(24-15)23-9(2)3/h5-7,9,19-20H,4H2,1-3H3 |
| InChIKey | JFHOOWDTITWEIJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|