C25H20ClN5O4S — CID 127029312
ethyl 3-(4-chlorophenyl)-4-cyano-5-[[3-[(4-nitrophenyl)methyl]imidazol-4-yl]methylamino]thiophene-2-carboxylate (PubChem CID 127029312) has the molecular formula C25H20ClN5O4S and a molecular weight of 521.99 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-4-cyano-5-[[3-[(4-nitrophenyl)methyl]imidazol-4-yl]methylamino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-(4-chlorophenyl)-4-cyano-5-[[3-[(4-nitrophenyl)methyl]imidazol-4-yl]methylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 127029312 |
| Molecular Formula | C25H20ClN5O4S |
| Molecular Weight | 521.99 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-4-cyano-5-[[3-[(4-nitrophenyl)methyl]imidazol-4-yl]methylamino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NCc2cncn2Cc2ccc([N+](=O)[O-])cc2)c(C#N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20ClN5O4S/c1-2-35-25(32)23-22(17-5-7-18(26)8-6-17)21(11-27)24(36-23)29-13-20-12-28-15-30(20)14-16-3-9-19(10-4-16)31(33)34/h3-10,12,15,29H,2,13-14H2,1H3 |
| InChIKey | PHKFROGFEMALBY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|