C15H11ClN2O3S — CID 176980515
ethyl 4-(4-chlorophenyl)-5-cyano-2-hydroxy-6-sulfanylidene-1H-pyridine-3-carboxylate (PubChem CID 176980515) has the molecular formula C15H11ClN2O3S and a molecular weight of 334.78 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-5-cyano-2-hydroxy-6-sulfanylidene-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-5-cyano-2-hydroxy-6-sulfanylidene-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 176980515 |
| Molecular Formula | C15H11ClN2O3S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-5-cyano-2-hydroxy-6-sulfanylidene-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)[nH]c(=S)c(C#N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClN2O3S/c1-2-21-15(20)12-11(8-3-5-9(16)6-4-8)10(7-17)14(22)18-13(12)19/h3-6H,2H2,1H3,(H2,18,19,22) |
| InChIKey | GUUHHHIHTOYZBE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|