C22H16O4 — CID 10759860
methyl 2-ethyl-6,11-dioxotetracene-1-carboxylate (PubChem CID 10759860) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is methyl 2-ethyl-6,11-dioxotetracene-1-carboxylate.
| Compound Name | methyl 2-ethyl-6,11-dioxotetracene-1-carboxylate |
|---|---|
| PubChem CID | 10759860 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl 2-ethyl-6,11-dioxotetracene-1-carboxylate |
| SMILES | CCc1ccc2cc3c(cc2c1C(=O)OC)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C22H16O4/c1-3-12-8-9-13-10-17-18(11-16(13)19(12)22(25)26-2)21(24)15-7-5-4-6-14(15)20(17)23/h4-11H,3H2,1-2H3 |
| InChIKey | PLQFSUAHQWCAFR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|