C23H16FNO3 — CID 136722831
6-fluoro-2-[4-(4-hydroxyphenyl)phenyl]-3-methylquinoline-4-carboxylic acid (PubChem CID 136722831) has the molecular formula C23H16FNO3 and a molecular weight of 373.38 g/mol. Its IUPAC name is 6-fluoro-2-[4-(4-hydroxyphenyl)phenyl]-3-methylquinoline-4-carboxylic acid.
| Compound Name | 6-fluoro-2-[4-(4-hydroxyphenyl)phenyl]-3-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 136722831 |
| Molecular Formula | C23H16FNO3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-fluoro-2-[4-(4-hydroxyphenyl)phenyl]-3-methylquinoline-4-carboxylic acid |
| SMILES | Cc1c(-c2ccc(-c3ccc(O)cc3)cc2)nc2ccc(F)cc2c1C(=O)O |
| InChI | InChI=1S/C23H16FNO3/c1-13-21(23(27)28)19-12-17(24)8-11-20(19)25-22(13)16-4-2-14(3-5-16)15-6-9-18(26)10-7-15/h2-12,26H,1H3,(H,27,28) |
| InChIKey | VPAYXVXXTWMTTK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |