C24H14F4NNaO2 — CID 23673428
sodium 6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate (PubChem CID 23673428) has the molecular formula C24H14F4NNaO2 and a molecular weight of 447.36 g/mol. Its IUPAC name is sodium 6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate.
| Compound Name | sodium 6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23673428 |
| Molecular Formula | C24H14F4NNaO2 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | sodium 6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)nc2ccc(F)cc2c1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C24H15F4NO2.Na/c1-13-21(23(30)31)19-12-18(25)10-11-20(19)29-22(13)16-4-2-14(3-5-16)15-6-8-17(9-7-15)24(26,27)28;/h2-12H,1H3,(H,30,31);/q;+1/p-1 |
| InChIKey | FKKBAGHPRFJKTE-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |