C30H30FNO3 — CID 169256248
ethyl 2-(4-tert-butyl-2-methylphenyl)-6-fluoro-4-phenylmethoxyquinoline-3-carboxylate (PubChem CID 169256248) has the molecular formula C30H30FNO3 and a molecular weight of 471.57 g/mol. Its IUPAC name is ethyl 2-(4-tert-butyl-2-methylphenyl)-6-fluoro-4-phenylmethoxyquinoline-3-carboxylate.
| Compound Name | ethyl 2-(4-tert-butyl-2-methylphenyl)-6-fluoro-4-phenylmethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 169256248 |
| Molecular Formula | C30H30FNO3 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | ethyl 2-(4-tert-butyl-2-methylphenyl)-6-fluoro-4-phenylmethoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C(C)(C)C)cc2C)nc2ccc(F)cc2c1OCc1ccccc1 |
| InChI | InChI=1S/C30H30FNO3/c1-6-34-29(33)26-27(23-14-12-21(16-19(23)2)30(3,4)5)32-25-15-13-22(31)17-24(25)28(26)35-18-20-10-8-7-9-11-20/h7-17H,6,18H2,1-5H3 |
| InChIKey | NPUXLXMEWSWAQS-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |