C10H7Cl2NPt — CID 159361617
3,4-dichloro-2-methylquinoline;platinum (PubChem CID 159361617) has the molecular formula C10H7Cl2NPt and a molecular weight of 407.16 g/mol. Its IUPAC name is 3,4-dichloro-2-methylquinoline;platinum.
| Compound Name | 3,4-dichloro-2-methylquinoline;platinum |
|---|---|
| PubChem CID | 159361617 |
| Molecular Formula | C10H7Cl2NPt |
| Molecular Weight | 407.16 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 3,4-dichloro-2-methylquinoline;platinum |
| SMILES | Cc1nc2ccccc2c(Cl)c1Cl.[Pt] |
| InChI | InChI=1S/C10H7Cl2N.Pt/c1-6-9(11)10(12)7-4-2-3-5-8(7)13-6;/h2-5H,1H3; |
| InChIKey | LIPPGHVACMTZIG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |