C23H25N3O — CID 72876256
(2-pyridin-2-ylpiperidin-1-yl)-(2,3,6-trimethylquinolin-4-yl)methanone (PubChem CID 72876256) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (2-pyridin-2-ylpiperidin-1-yl)-(2,3,6-trimethylquinolin-4-yl)methanone.
| Compound Name | (2-pyridin-2-ylpiperidin-1-yl)-(2,3,6-trimethylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 72876256 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (2-pyridin-2-ylpiperidin-1-yl)-(2,3,6-trimethylquinolin-4-yl)methanone |
| SMILES | Cc1ccc2nc(C)c(C)c(C(=O)N3CCCCC3c3ccccn3)c2c1 |
| InChI | InChI=1S/C23H25N3O/c1-15-10-11-19-18(14-15)22(16(2)17(3)25-19)23(27)26-13-7-5-9-21(26)20-8-4-6-12-24-20/h4,6,8,10-12,14,21H,5,7,9,13H2,1-3H3 |
| InChIKey | CXJOXZGOQDLVEE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |