C15H21F3N4O2 — CID 129486424
[(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methanone (PubChem CID 129486424) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is [(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methanone.
| Compound Name | [(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 129486424 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methanone |
| SMILES | Cc1nn(CC(F)(F)F)cc1C(=O)N1CCO[C@@H]2CCN(C)C[C@H]21 |
| InChI | InChI=1S/C15H21F3N4O2/c1-10-11(7-21(19-10)9-15(16,17)18)14(23)22-5-6-24-13-3-4-20(2)8-12(13)22/h7,12-13H,3-6,8-9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | UDNGMPOWJKRQSG-CHWSQXEVSA-N |
| XLogP | 1.30 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |