C15H18F3N3O3 — CID 154847884
(3aR,6aS)-2-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 154847884) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is (3aR,6aS)-2-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,6aS)-2-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 154847884 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (3aR,6aS)-2-[3-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | Cc1nn(CC(F)(F)F)cc1C(=O)N1C[C@H]2CC(C(=O)O)C[C@H]2C1 |
| InChI | InChI=1S/C15H18F3N3O3/c1-8-12(6-21(19-8)7-15(16,17)18)13(22)20-4-10-2-9(14(23)24)3-11(10)5-20/h6,9-11H,2-5,7H2,1H3,(H,23,24)/t9?,10-,11+ |
| InChIKey | OSZTVEILKBTFHL-FGWVZKOKSA-N |
| XLogP | 1.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |