C15H16FNO4 — CID 76913957
3-[2-fluoro-4-(2-methylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid (PubChem CID 76913957) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is 3-[2-fluoro-4-(2-methylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-fluoro-4-(2-methylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76913957 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-[2-fluoro-4-(2-methylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid |
| SMILES | CC1CN(C(=O)c2ccc(C=CC(=O)O)c(F)c2)CCO1 |
| InChI | InChI=1S/C15H16FNO4/c1-10-9-17(6-7-21-10)15(20)12-3-2-11(13(16)8-12)4-5-14(18)19/h2-5,8,10H,6-7,9H2,1H3,(H,18,19) |
| InChIKey | OJRLPSYSEJPJAH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|