C17H25N3O2 — CID 95567687
(3S)-1-[(E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]pyrrolidine-3-carboxamide (PubChem CID 95567687) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (3S)-1-[(E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[(E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95567687 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (3S)-1-[(E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]pyrrolidine-3-carboxamide |
| SMILES | CCCn1c(C)cc(/C=C/C(=O)N2CC[C@H](C(N)=O)C2)c1C |
| InChI | InChI=1S/C17H25N3O2/c1-4-8-20-12(2)10-14(13(20)3)5-6-16(21)19-9-7-15(11-19)17(18)22/h5-6,10,15H,4,7-9,11H2,1-3H3,(H2,18,22)/b6-5+/t15-/m0/s1 |
| InChIKey | AIXRYQWUUBMMGS-NFAHFFEMSA-N |
| XLogP | 1.86 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|