C21H30N2O — CID 8732836
(E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-en-1-one (PubChem CID 8732836) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8732836 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-en-1-one |
| SMILES | Cc1cc(/C=C/C(=O)N2CC[C@@H]3CCCC[C@H]3C2)c(C)n1C1CC1 |
| InChI | InChI=1S/C21H30N2O/c1-15-13-18(16(2)23(15)20-8-9-20)7-10-21(24)22-12-11-17-5-3-4-6-19(17)14-22/h7,10,13,17,19-20H,3-6,8-9,11-12,14H2,1-2H3/b10-7+/t17-,19-/m0/s1 |
| InChIKey | RLHASMQGXQKEEJ-YPZZQQJBSA-N |
| XLogP | 4.49 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|