C15H22N2O — CID 47123773
(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide (PubChem CID 47123773) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 47123773 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide |
| SMILES | Cc1cc(/C=C/C(N)=O)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C15H22N2O/c1-11-10-13(8-9-15(16)18)12(2)17(11)14-6-4-3-5-7-14/h8-10,14H,3-7H2,1-2H3,(H2,16,18)/b9-8+ |
| InChIKey | POGHOTWQMXDSEH-CMDGGOBGSA-N |
| XLogP | 3.11 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|