C20H31N3O3S — CID 51305543
(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 51305543) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51305543 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | Cc1cc(/C=C/C(=O)N2CCN(S(C)(=O)=O)CC2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C20H31N3O3S/c1-16-15-18(17(2)23(16)19-7-5-4-6-8-19)9-10-20(24)21-11-13-22(14-12-21)27(3,25)26/h9-10,15,19H,4-8,11-14H2,1-3H3/b10-9+ |
| InChIKey | PLUBBOBLZCDNFT-MDZDMXLPSA-N |
| XLogP | 2.73 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|