C16H22N2O3S — CID 51305566
(E)-3-(2,4-dimethylphenyl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 51305566) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51305566 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-1-(4-methylsulfonylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCN(S(C)(=O)=O)CC2)c(C)c1 |
| InChI | InChI=1S/C16H22N2O3S/c1-13-4-5-15(14(2)12-13)6-7-16(19)17-8-10-18(11-9-17)22(3,20)21/h4-7,12H,8-11H2,1-3H3/b7-6+ |
| InChIKey | IYFGPTOCDNOICS-VOTSOKGWSA-N |
| XLogP | 1.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|