C23H28N2O — CID 46410011
(E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 46410011) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46410011 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (E)-1-(4-benzyl-1,4-diazepan-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCCN(Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H28N2O/c1-19-9-10-22(20(2)17-19)11-12-23(26)25-14-6-13-24(15-16-25)18-21-7-4-3-5-8-21/h3-5,7-12,17H,6,13-16,18H2,1-2H3/b12-11+ |
| InChIKey | VMABEKVTJFUYSZ-VAWYXSNFSA-N |
| XLogP | 4.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|