C21H32N2O2 — CID 51866191
(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]prop-2-en-1-one (PubChem CID 51866191) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 51866191 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]prop-2-en-1-one |
| SMILES | Cc1cc(/C=C/C(=O)N2C[C@H](C)O[C@@H](C)C2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C21H32N2O2/c1-15-12-19(18(4)23(15)20-8-6-5-7-9-20)10-11-21(24)22-13-16(2)25-17(3)14-22/h10-12,16-17,20H,5-9,13-14H2,1-4H3/b11-10+/t16-,17-/m0/s1 |
| InChIKey | ZBOZLVMNOFPWJA-YOIRJEGESA-N |
| XLogP | 4.26 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|