C21H33N3O2 — CID 55599737
3-[[(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]amino]-N-propan-2-ylpropanamide (PubChem CID 55599737) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 3-[[(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 55599737 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 3-[[(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)prop-2-enoyl]amino]-N-propan-2-ylpropanamide |
| SMILES | Cc1cc(/C=C/C(=O)NCCC(=O)NC(C)C)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C21H33N3O2/c1-15(2)23-21(26)12-13-22-20(25)11-10-18-14-16(3)24(17(18)4)19-8-6-5-7-9-19/h10-11,14-15,19H,5-9,12-13H2,1-4H3,(H,22,25)(H,23,26)/b11-10+ |
| InChIKey | LYWXWOYYGJQSRZ-ZHACJKMWSA-N |
| XLogP | 3.65 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|