C25H36N6O — CID 55993781
(E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]prop-2-enamide (PubChem CID 55993781) has the molecular formula C25H36N6O and a molecular weight of 436.60 g/mol. Its IUPAC name is (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55993781 |
| Molecular Formula | C25H36N6O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (E)-3-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C/C(=O)NCCN2CCN(c3ncccn3)CC2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C25H36N6O/c1-20-19-22(21(2)31(20)23-7-4-3-5-8-23)9-10-24(32)26-13-14-29-15-17-30(18-16-29)25-27-11-6-12-28-25/h6,9-12,19,23H,3-5,7-8,13-18H2,1-2H3,(H,26,32)/b10-9+ |
| InChIKey | FLVZZWFJXZSBIZ-MDZDMXLPSA-N |
| XLogP | 3.35 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|