C11H16N2O — CID 55266512
(Z)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide (PubChem CID 55266512) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (Z)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (Z)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55266512 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (Z)-3-(1-ethyl-2,5-dimethylpyrrol-3-yl)prop-2-enamide |
| SMILES | CCn1c(C)cc(/C=C\C(N)=O)c1C |
| InChI | InChI=1S/C11H16N2O/c1-4-13-8(2)7-10(9(13)3)5-6-11(12)14/h5-7H,4H2,1-3H3,(H2,12,14)/b6-5- |
| InChIKey | RTMMDLSDZYAECF-WAYWQWQTSA-N |
| XLogP | 1.62 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|