C16H21NO2 — CID 111561443
(E)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3-(2,4,5-trimethylphenyl)prop-2-en-1-one (PubChem CID 111561443) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3-(2,4,5-trimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3-(2,4,5-trimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 111561443 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (E)-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3-(2,4,5-trimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C)c(/C=C/C(=O)N2CC[C@@H](O)C2)cc1C |
| InChI | InChI=1S/C16H21NO2/c1-11-8-13(3)14(9-12(11)2)4-5-16(19)17-7-6-15(18)10-17/h4-5,8-9,15,18H,6-7,10H2,1-3H3/b5-4+/t15-/m1/s1 |
| InChIKey | HFFXYLZWQKICOS-MBVDDHJVSA-N |
| XLogP | 2.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|