C11H12BrNO2S — CID 111561194
3-(5-bromothiophen-3-yl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 111561194) has the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. Its IUPAC name is 3-(5-bromothiophen-3-yl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(5-bromothiophen-3-yl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 111561194 |
| Molecular Formula | C11H12BrNO2S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 3-(5-bromothiophen-3-yl)-1-[(3R)-3-hydroxypyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1csc(Br)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H12BrNO2S/c12-10-5-8(7-16-10)1-2-11(15)13-4-3-9(14)6-13/h1-2,5,7,9,14H,3-4,6H2/t9-/m1/s1 |
| InChIKey | ATESZPXNZLONHG-SECBINFHSA-N |
| XLogP | 2.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|