C23H25N3O — CID 42997386
(E)-N-benzyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-ethylprop-2-enamide (PubChem CID 42997386) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (E)-N-benzyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-ethylprop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 42997386 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (E)-N-benzyl-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-ethylprop-2-enamide |
| SMILES | CCN(Cc1ccccc1)C(=O)/C=C/c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C23H25N3O/c1-4-25(17-20-11-7-5-8-12-20)23(27)16-15-22-18(2)24-26(19(22)3)21-13-9-6-10-14-21/h5-16H,4,17H2,1-3H3/b16-15+ |
| InChIKey | MRCBBICJCNKXMP-FOCLMDBBSA-N |
| XLogP | 4.55 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|