C19H22ClN3O — CID 86939441
(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(cyclopropylmethyl)-N-ethylprop-2-enamide (PubChem CID 86939441) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(cyclopropylmethyl)-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(cyclopropylmethyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 86939441 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(cyclopropylmethyl)-N-ethylprop-2-enamide |
| SMILES | CCN(CC1CC1)C(=O)/C=C/c1c(C)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C19H22ClN3O/c1-3-22(13-15-9-10-15)18(24)12-11-17-14(2)21-23(19(17)20)16-7-5-4-6-8-16/h4-8,11-12,15H,3,9-10,13H2,1-2H3/b12-11+ |
| InChIKey | ADCKBVSQSYXKGO-VAWYXSNFSA-N |
| XLogP | 4.11 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|