C25H25ClFN5O3 — CID 25163747
(E)-N-[2-(4-acetamidoanilino)-2-oxoethyl]-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-ethylprop-2-enamide (PubChem CID 25163747) has the molecular formula C25H25ClFN5O3 and a molecular weight of 497.96 g/mol. Its IUPAC name is (E)-N-[2-(4-acetamidoanilino)-2-oxoethyl]-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-ethylprop-2-enamide.
| Compound Name | (E)-N-[2-(4-acetamidoanilino)-2-oxoethyl]-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 25163747 |
| Molecular Formula | C25H25ClFN5O3 |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (E)-N-[2-(4-acetamidoanilino)-2-oxoethyl]-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]-N-ethylprop-2-enamide |
| SMILES | CCN(CC(=O)Nc1ccc(NC(C)=O)cc1)C(=O)/C=C/c1c(C)nn(-c2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C25H25ClFN5O3/c1-4-31(15-23(34)29-20-9-7-19(8-10-20)28-17(3)33)24(35)14-13-22-16(2)30-32(25(22)26)21-11-5-18(27)6-12-21/h5-14H,4,15H2,1-3H3,(H,28,33)(H,29,34)/b14-13+ |
| InChIKey | OMDLLCOTEWMYKX-BUHFOSPRSA-N |
| XLogP | 4.43 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|