C22H16ClFN4O3 — CID 4856875
[2-(3-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 4856875) has the molecular formula C22H16ClFN4O3 and a molecular weight of 438.85 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4856875 |
| Molecular Formula | C22H16ClFN4O3 |
| Molecular Weight | 438.85 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C=CC(=O)OCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H16ClFN4O3/c1-14-19(22(23)28(27-14)18-7-5-16(24)6-8-18)9-10-21(30)31-13-20(29)26-17-4-2-3-15(11-17)12-25/h2-11H,13H2,1H3,(H,26,29) |
| InChIKey | ZCOMAGNZAGUTDP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.85 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|