C19H14ClF2N3O2 — CID 166201250
(5-fluoro-3-pyridinyl)methyl (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 166201250) has the molecular formula C19H14ClF2N3O2 and a molecular weight of 389.79 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl)methyl (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (5-fluoro-3-pyridinyl)methyl (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 166201250 |
| Molecular Formula | C19H14ClF2N3O2 |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | (5-fluoro-3-pyridinyl)methyl (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=C/C(=O)OCc1cncc(F)c1 |
| InChI | InChI=1S/C19H14ClF2N3O2/c1-12-17(19(20)25(24-12)16-4-2-14(21)3-5-16)6-7-18(26)27-11-13-8-15(22)10-23-9-13/h2-10H,11H2,1H3/b7-6+ |
| InChIKey | DCJBAKKSHYYMSR-VOTSOKGWSA-N |
| XLogP | 4.26 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|