C24H21FN4O3 — CID 40987317
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate (PubChem CID 40987317) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 40987317 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] (E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=C/C(=O)O[C@@H](C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C24H21FN4O3/c1-15-22(16(2)29(28-15)21-9-7-19(25)8-10-21)11-12-23(30)32-17(3)24(31)27-20-6-4-5-18(13-20)14-26/h4-13,17H,1-3H3,(H,27,31)/b12-11+/t17-/m0/s1 |
| InChIKey | UIUNAOJMANTZFN-FLVLSHQESA-N |
| XLogP | 4.08 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|