C21H26F3N3O — CID 56531461
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 56531461) has the molecular formula C21H26F3N3O and a molecular weight of 393.45 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 56531461 |
| Molecular Formula | C21H26F3N3O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2,2-dimethylpropyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)N(CC(C)(C)C)CC(F)(F)F |
| InChI | InChI=1S/C21H26F3N3O/c1-15-18(16(2)27(25-15)17-9-7-6-8-10-17)11-12-19(28)26(13-20(3,4)5)14-21(22,23)24/h6-12H,13-14H2,1-5H3/b12-11+ |
| InChIKey | PFBOAXRKFQRRNL-VAWYXSNFSA-N |
| XLogP | 4.94 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|