C18H19N3O3S — CID 122412836
(E)-3-(1,3-benzodioxol-5-yl)-N-pyrazolidin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 122412836) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-pyrazolidin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-pyrazolidin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 122412836 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-pyrazolidin-3-yl-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N(Cc1cccs1)C1CCNN1 |
| InChI | InChI=1S/C18H19N3O3S/c22-18(6-4-13-3-5-15-16(10-13)24-12-23-15)21(17-7-8-19-20-17)11-14-2-1-9-25-14/h1-6,9-10,17,19-20H,7-8,11-12H2/b6-4+ |
| InChIKey | SYOWIHSSQDGUQM-GQCTYLIASA-N |
| XLogP | 2.34 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|