C22H18FNO3S — CID 18224661
(E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 18224661) has the molecular formula C22H18FNO3S and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 18224661 |
| Molecular Formula | C22H18FNO3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-fluorophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N(Cc1cccs1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H18FNO3S/c23-17-6-3-16(4-7-17)5-10-22(25)24(15-19-2-1-13-28-19)18-8-9-20-21(14-18)27-12-11-26-20/h1-10,13-14H,11-12,15H2/b10-5+ |
| InChIKey | IOKZBRDUKBWGOS-BJMVGYQFSA-N |
| XLogP | 4.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|