C22H18N2O5S — CID 39708976
(E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-nitrophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 39708976) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-nitrophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-nitrophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 39708976 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-nitrophenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])N(Cc1cccs1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H18N2O5S/c25-22(10-7-16-4-1-2-6-19(16)24(26)27)23(15-18-5-3-13-30-18)17-8-9-20-21(14-17)29-12-11-28-20/h1-10,13-14H,11-12,15H2/b10-7+ |
| InChIKey | NINSAVSFMQVODQ-JXMROGBWSA-N |
| XLogP | 4.67 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|