C22H18N2O7S — CID 29170449
[2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-nitrobenzoate (PubChem CID 29170449) has the molecular formula C22H18N2O7S and a molecular weight of 454.46 g/mol. Its IUPAC name is [2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 29170449 |
| Molecular Formula | C22H18N2O7S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | [2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-2-oxoethyl] 3-nitrobenzoate |
| SMILES | O=C(OCC(=O)N(Cc1cccs1)c1ccc2c(c1)OCCO2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N2O7S/c25-21(14-31-22(26)15-3-1-4-17(11-15)24(27)28)23(13-18-5-2-10-32-18)16-6-7-19-20(12-16)30-9-8-29-19/h1-7,10-12H,8-9,13-14H2 |
| InChIKey | DWWPUXWNGBOORD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|