C18H23ClN6OS2 — CID 134013581
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide (PubChem CID 134013581) has the molecular formula C18H23ClN6OS2 and a molecular weight of 439.01 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 134013581 |
| Molecular Formula | C18H23ClN6OS2 |
| Molecular Weight | 439.01 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide |
| SMILES | CSc1nnc(CCCNC(=O)/C=C/c2c(Cl)nc3sccn23)n1CC(C)C |
| InChI | InChI=1S/C18H23ClN6OS2/c1-12(2)11-25-14(22-23-18(25)27-3)5-4-8-20-15(26)7-6-13-16(19)21-17-24(13)9-10-28-17/h6-7,9-10,12H,4-5,8,11H2,1-3H3,(H,20,26)/b7-6+ |
| InChIKey | QBXNGEXWIXKADD-VOTSOKGWSA-N |
| XLogP | 3.78 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.01 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|