C20H26F2N4O2S — CID 55491860
3-[2-(difluoromethoxy)phenyl]-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide (PubChem CID 55491860) has the molecular formula C20H26F2N4O2S and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 55491860 |
| Molecular Formula | C20H26F2N4O2S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]prop-2-enamide |
| SMILES | CSc1nnc(CCCNC(=O)C=Cc2ccccc2OC(F)F)n1CC(C)C |
| InChI | InChI=1S/C20H26F2N4O2S/c1-14(2)13-26-17(24-25-20(26)29-3)9-6-12-23-18(27)11-10-15-7-4-5-8-16(15)28-19(21)22/h4-5,7-8,10-11,14,19H,6,9,12-13H2,1-3H3,(H,23,27) |
| InChIKey | BHLLGIGMBRQWMV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|