C21H26N6OS — CID 134013589
(E)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 134013589) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is (E)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 134013589 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (E)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | CSc1nnc(CCCNC(=O)/C=C/c2cnc3ccccc3n2)n1CC(C)C |
| InChI | InChI=1S/C21H26N6OS/c1-15(2)14-27-19(25-26-21(27)29-3)9-6-12-22-20(28)11-10-16-13-23-17-7-4-5-8-18(17)24-16/h4-5,7-8,10-11,13,15H,6,9,12,14H2,1-3H3,(H,22,28)/b11-10+ |
| InChIKey | QGCQKEKGLJIOJE-ZHACJKMWSA-N |
| XLogP | 3.36 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|